C21H20N2O4 — CID 43008844
pyridin-2-ylmethyl 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 43008844) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is pyridin-2-ylmethyl 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | pyridin-2-ylmethyl 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 43008844 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | pyridin-2-ylmethyl 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(OCc1ccccn1)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O |
| InChI | InChI=1S/C21H20N2O4/c24-19-17-10-9-14(21(26)27-13-15-6-4-5-11-22-15)12-18(17)20(25)23(19)16-7-2-1-3-8-16/h4-6,9-12,16H,1-3,7-8,13H2 |
| InChIKey | QYHYINUPAAFWIA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|