C30H20N2O4 — CID 20598581
bis(pyridin-2-ylmethyl) fluoranthene-3,9-dicarboxylate (PubChem CID 20598581) has the molecular formula C30H20N2O4 and a molecular weight of 472.50 g/mol. Its IUPAC name is bis(pyridin-2-ylmethyl) fluoranthene-3,9-dicarboxylate.
| Compound Name | bis(pyridin-2-ylmethyl) fluoranthene-3,9-dicarboxylate |
|---|---|
| PubChem CID | 20598581 |
| Molecular Formula | C30H20N2O4 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | bis(pyridin-2-ylmethyl) fluoranthene-3,9-dicarboxylate |
| SMILES | O=C(OCc1ccccn1)c1ccc2c(c1)-c1ccc(C(=O)OCc3ccccn3)c3cccc-2c13 |
| InChI | InChI=1S/C30H20N2O4/c33-29(35-17-20-6-1-3-14-31-20)19-10-11-22-23-8-5-9-24-26(13-12-25(28(23)24)27(22)16-19)30(34)36-18-21-7-2-4-15-32-21/h1-16H,17-18H2 |
| InChIKey | PVOFXKYGJFCUNV-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |