C36H48N2O4 — CID 515655
bis[3-(dipropylamino)propyl] fluoranthene-3,9-dicarboxylate (PubChem CID 515655) has the molecular formula C36H48N2O4 and a molecular weight of 572.79 g/mol. Its IUPAC name is bis[3-(dipropylamino)propyl] fluoranthene-3,9-dicarboxylate.
| Compound Name | bis[3-(dipropylamino)propyl] fluoranthene-3,9-dicarboxylate |
|---|---|
| PubChem CID | 515655 |
| Molecular Formula | C36H48N2O4 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.36 |
| IUPAC Name | bis[3-(dipropylamino)propyl] fluoranthene-3,9-dicarboxylate |
| SMILES | CCCN(CCC)CCCOC(=O)c1ccc2c(c1)-c1ccc(C(=O)OCCCN(CCC)CCC)c3cccc-2c13 |
| InChI | InChI=1S/C36H48N2O4/c1-5-18-37(19-6-2)22-10-24-41-35(39)27-14-15-28-29-12-9-13-30-32(17-16-31(34(29)30)33(28)26-27)36(40)42-25-11-23-38(20-7-3)21-8-4/h9,12-17,26H,5-8,10-11,18-25H2,1-4H3 |
| InChIKey | ZKWSAISSFPDUHI-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|