C36H40N2O4 — CID 515647
bis[3-[bis(prop-2-enyl)amino]propyl] fluoranthene-3,8-dicarboxylate (PubChem CID 515647) has the molecular formula C36H40N2O4 and a molecular weight of 564.73 g/mol. Its IUPAC name is bis[3-[bis(prop-2-enyl)amino]propyl] fluoranthene-3,8-dicarboxylate.
| Compound Name | bis[3-[bis(prop-2-enyl)amino]propyl] fluoranthene-3,8-dicarboxylate |
|---|---|
| PubChem CID | 515647 |
| Molecular Formula | C36H40N2O4 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | bis[3-[bis(prop-2-enyl)amino]propyl] fluoranthene-3,8-dicarboxylate |
| SMILES | C=CCN(CC=C)CCCOC(=O)c1ccc2c(c1)-c1cccc3c(C(=O)OCCCN(CC=C)CC=C)ccc-2c13 |
| InChI | InChI=1S/C36H40N2O4/c1-5-18-37(19-6-2)22-10-24-41-35(39)27-14-15-28-31-16-17-32(29-12-9-13-30(34(29)31)33(28)26-27)36(40)42-25-11-23-38(20-7-3)21-8-4/h5-9,12-17,26H,1-4,10-11,18-25H2 |
| InChIKey | NHIDMBBUCPPMDZ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|