C20H20N2O4 — CID 42577255
pyridin-2-ylmethyl 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 42577255) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is pyridin-2-ylmethyl 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | pyridin-2-ylmethyl 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 42577255 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | pyridin-2-ylmethyl 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(C)CCN1C(=O)c2ccc(C(=O)OCc3ccccn3)cc2C1=O |
| InChI | InChI=1S/C20H20N2O4/c1-13(2)8-10-22-18(23)16-7-6-14(11-17(16)19(22)24)20(25)26-12-15-5-3-4-9-21-15/h3-7,9,11,13H,8,10,12H2,1-2H3 |
| InChIKey | KLLGTEZCALPVBD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|