C21H19N3O3 — CID 4791992
3-[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]-3-oxo-2-pyridin-2-ylpropanenitrile (PubChem CID 4791992) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is 3-[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]-3-oxo-2-pyridin-2-ylpropanenitrile.
| Compound Name | 3-[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]-3-oxo-2-pyridin-2-ylpropanenitrile |
|---|---|
| PubChem CID | 4791992 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 3-[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]-3-oxo-2-pyridin-2-ylpropanenitrile |
| SMILES | CC(C)CCN1C(=O)c2ccc(C(=O)C(C#N)c3ccccn3)cc2C1=O |
| InChI | InChI=1S/C21H19N3O3/c1-13(2)8-10-24-20(26)15-7-6-14(11-16(15)21(24)27)19(25)17(12-22)18-5-3-4-9-23-18/h3-7,9,11,13,17H,8,10H2,1-2H3 |
| InChIKey | XRGIOSXNAHRDMB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 91.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|