About (2S)-3-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]-3-oxo-2-pyridin-2-ylpropanenitrile
(2S)-3-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]-3-oxo-2-pyridin-2-ylpropanenitrile (PubChem CID 40647072) has the molecular formula C18H13N3O3
and a molecular weight of 319.32 g/mol. Its IUPAC name is (2S)-3-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]-3-oxo-2-pyridin-2-ylpropanenitrile.
Molecular Properties
| Compound Name | (2S)-3-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]-3-oxo-2-pyridin-2-ylpropanenitrile |
| PubChem CID | 40647072 |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (2S)-3-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]-3-oxo-2-pyridin-2-ylpropanenitrile |
| SMILES | N#C[C@@H](C(=O)c1cccc(N2C(=O)CCC2=O)c1)c1ccccn1 |
| InChI | InChI=1S/C18H13N3O3/c19-11-14(15-6-1-2-9-20-15)18(24)12-4-3-5-13(10-12)21-16(22)7-8-17(21)23/h1-6,9-10,14H,7-8H2/t14-/m1/s1 |
| InChIKey | UUKOTYHLKAPIDN-CQSZACIVSA-N |
| XLogP | 2.23 |
| TPSA | 91.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]-3-oxo-2-pyridin-2-ylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]-3-oxo-2-pyridin-2-ylpropanenitrile?
The IUPAC name of (2S)-3-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]-3-oxo-2-pyridin-2-ylpropanenitrile (CID 40647072) is (2S)-3-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]-3-oxo-2-pyridin-2-ylpropanenitrile.
What is the SMILES notation for (2S)-3-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]-3-oxo-2-pyridin-2-ylpropanenitrile?
The canonical SMILES for (2S)-3-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]-3-oxo-2-pyridin-2-ylpropanenitrile is N#C[C@@H](C(=O)c1cccc(N2C(=O)CCC2=O)c1)c1ccccn1.
What is the InChIKey of (2S)-3-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]-3-oxo-2-pyridin-2-ylpropanenitrile?
The InChIKey is UUKOTYHLKAPIDN-CQSZACIVSA-N. The full InChI is InChI=1S/C18H13N3O3/c19-11-14(15-6-1-2-9-20-15)18(24)12-4-3-5-13(10-12)21-16(22)7-8-17(21)23/h1-6,9-10,14H,7-8H2/t14-/m1/s1.
What are the key properties of (2S)-3-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]-3-oxo-2-pyridin-2-ylpropanenitrile?
(2S)-3-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]-3-oxo-2-pyridin-2-ylpropanenitrile has a molecular weight of 319.32 g/mol, XLogP of 2.23, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]-3-oxo-2-pyridin-2-ylpropanenitrile is sourced from PubChem (CID 40647072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).