C14H17NO3 — CID 145439444
1-(3-acetylphenyl)pyrrolidine-2,5-dione;ethane (PubChem CID 145439444) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 1-(3-acetylphenyl)pyrrolidine-2,5-dione;ethane.
| Compound Name | 1-(3-acetylphenyl)pyrrolidine-2,5-dione;ethane |
|---|---|
| PubChem CID | 145439444 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 1-(3-acetylphenyl)pyrrolidine-2,5-dione;ethane |
| SMILES | CC.CC(=O)c1cccc(N2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C12H11NO3.C2H6/c1-8(14)9-3-2-4-10(7-9)13-11(15)5-6-12(13)16;1-2/h2-4,7H,5-6H2,1H3;1-2H3 |
| InChIKey | PDAJNWLDWUWNHU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|