C14H9N3O3 — CID 17255818
6-(3-acetylphenyl)pyrrolo[3,4-b]pyrazine-5,7-dione (PubChem CID 17255818) has the molecular formula C14H9N3O3 and a molecular weight of 267.24 g/mol. Its IUPAC name is 6-(3-acetylphenyl)pyrrolo[3,4-b]pyrazine-5,7-dione.
| Compound Name | 6-(3-acetylphenyl)pyrrolo[3,4-b]pyrazine-5,7-dione |
|---|---|
| PubChem CID | 17255818 |
| Molecular Formula | C14H9N3O3 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 6-(3-acetylphenyl)pyrrolo[3,4-b]pyrazine-5,7-dione |
| SMILES | CC(=O)c1cccc(N2C(=O)c3nccnc3C2=O)c1 |
| InChI | InChI=1S/C14H9N3O3/c1-8(18)9-3-2-4-10(7-9)17-13(19)11-12(14(17)20)16-6-5-15-11/h2-7H,1H3 |
| InChIKey | OTBLPQXIXJULFD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|