C14H12N2O4 — CID 7204595
[(1S)-1-cyanoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 7204595) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [(1S)-1-cyanoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 7204595 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | [(1S)-1-cyanoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | C[C@@H](C#N)OC(=O)c1cccc(N2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C14H12N2O4/c1-9(8-15)20-14(19)10-3-2-4-11(7-10)16-12(17)5-6-13(16)18/h2-4,7,9H,5-6H2,1H3/t9-/m0/s1 |
| InChIKey | YGJPCVGOHUZZSA-VIFPVBQESA-N |
| XLogP | 1.41 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|