C14H14N2O3 — CID 4030036
1-cyanoethyl 4-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 4030036) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 1-cyanoethyl 4-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | 1-cyanoethyl 4-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 4030036 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-cyanoethyl 4-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | CC(C#N)OC(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C14H14N2O3/c1-10(9-15)19-14(18)11-4-6-12(7-5-11)16-8-2-3-13(16)17/h4-7,10H,2-3,8H2,1H3 |
| InChIKey | UVYYHVPGQXKDDM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |