C18H14N2O9 — CID 90373482
1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 3-(2,5-dioxopyrrol-1-yl)benzoate (PubChem CID 90373482) has the molecular formula C18H14N2O9 and a molecular weight of 402.32 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 3-(2,5-dioxopyrrol-1-yl)benzoate.
| Compound Name | 1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 3-(2,5-dioxopyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 90373482 |
| Molecular Formula | C18H14N2O9 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 3-(2,5-dioxopyrrol-1-yl)benzoate |
| SMILES | CC(OC(=O)ON1C(=O)CCC1=O)OC(=O)c1cccc(N2C(=O)C=CC2=O)c1 |
| InChI | InChI=1S/C18H14N2O9/c1-10(28-18(26)29-20-15(23)7-8-16(20)24)27-17(25)11-3-2-4-12(9-11)19-13(21)5-6-14(19)22/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | WKVRRDYPQMDFBQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 136.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|