C12H11NO4 — CID 761230
[3-(2,5-dioxopyrrolidin-1-yl)phenyl] acetate (PubChem CID 761230) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is [3-(2,5-dioxopyrrolidin-1-yl)phenyl] acetate.
| Compound Name | [3-(2,5-dioxopyrrolidin-1-yl)phenyl] acetate |
|---|---|
| PubChem CID | 761230 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | [3-(2,5-dioxopyrrolidin-1-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(N2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C12H11NO4/c1-8(14)17-10-4-2-3-9(7-10)13-11(15)5-6-12(13)16/h2-4,7H,5-6H2,1H3 |
| InChIKey | NJUGOHXWYXHCKU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|