C16H12N2O4 — CID 703427
[3-(4-amino-1,3-dioxoisoindol-2-yl)phenyl] acetate (PubChem CID 703427) has the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. Its IUPAC name is [3-(4-amino-1,3-dioxoisoindol-2-yl)phenyl] acetate.
| Compound Name | [3-(4-amino-1,3-dioxoisoindol-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 703427 |
| Molecular Formula | C16H12N2O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | [3-(4-amino-1,3-dioxoisoindol-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(N2C(=O)c3cccc(N)c3C2=O)c1 |
| InChI | InChI=1S/C16H12N2O4/c1-9(19)22-11-5-2-4-10(8-11)18-15(20)12-6-3-7-13(17)14(12)16(18)21/h2-8H,17H2,1H3 |
| InChIKey | ZNIVUTSFGMRMOV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|