C21H19Cl2NO4 — CID 4306155
(3,4-dichlorophenyl)methyl 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4306155) has the molecular formula C21H19Cl2NO4 and a molecular weight of 420.29 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (3,4-dichlorophenyl)methyl 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4306155 |
| Molecular Formula | C21H19Cl2NO4 |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(C)CCN1C(=O)c2ccc(C(=O)OCc3ccc(Cl)c(Cl)c3)cc2C1=O |
| InChI | InChI=1S/C21H19Cl2NO4/c1-12(2)7-8-24-19(25)15-5-4-14(10-16(15)20(24)26)21(27)28-11-13-3-6-17(22)18(23)9-13/h3-6,9-10,12H,7-8,11H2,1-2H3 |
| InChIKey | DKFOEAHFLYKZCF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|