C26H30N2O5 — CID 2425007
[2-(4-tert-butylanilino)-2-oxoethyl] 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2425007) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is [2-(4-tert-butylanilino)-2-oxoethyl] 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(4-tert-butylanilino)-2-oxoethyl] 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2425007 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | [2-(4-tert-butylanilino)-2-oxoethyl] 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(C)CCN1C(=O)c2ccc(C(=O)OCC(=O)Nc3ccc(C(C)(C)C)cc3)cc2C1=O |
| InChI | InChI=1S/C26H30N2O5/c1-16(2)12-13-28-23(30)20-11-6-17(14-21(20)24(28)31)25(32)33-15-22(29)27-19-9-7-18(8-10-19)26(3,4)5/h6-11,14,16H,12-13,15H2,1-5H3,(H,27,29) |
| InChIKey | VSXIQJJGRCLAAL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|