C23H20N4O7 — CID 4843728
[2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4843728) has the molecular formula C23H20N4O7 and a molecular weight of 464.43 g/mol. Its IUPAC name is [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4843728 |
| Molecular Formula | C23H20N4O7 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(C)CCN1C(=O)c2ccc(C(=O)OCC(=O)Nc3ccc([N+](=O)[O-])cc3C#N)cc2C1=O |
| InChI | InChI=1S/C23H20N4O7/c1-13(2)7-8-26-21(29)17-5-3-14(10-18(17)22(26)30)23(31)34-12-20(28)25-19-6-4-16(27(32)33)9-15(19)11-24/h3-6,9-10,13H,7-8,12H2,1-2H3,(H,25,28) |
| InChIKey | NRWFIAFJKMUUIP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 159.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|