C23H25N3O3 — CID 134017566
2-cyclohexyl-N-methyl-1,3-dioxo-N-(2-pyridin-2-ylethyl)isoindole-5-carboxamide (PubChem CID 134017566) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-cyclohexyl-N-methyl-1,3-dioxo-N-(2-pyridin-2-ylethyl)isoindole-5-carboxamide.
| Compound Name | 2-cyclohexyl-N-methyl-1,3-dioxo-N-(2-pyridin-2-ylethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 134017566 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-cyclohexyl-N-methyl-1,3-dioxo-N-(2-pyridin-2-ylethyl)isoindole-5-carboxamide |
| SMILES | CN(CCc1ccccn1)C(=O)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O |
| InChI | InChI=1S/C23H25N3O3/c1-25(14-12-17-7-5-6-13-24-17)21(27)16-10-11-19-20(15-16)23(29)26(22(19)28)18-8-3-2-4-9-18/h5-7,10-11,13,15,18H,2-4,8-9,12,14H2,1H3 |
| InChIKey | NGRRLDNTGDDGLU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|