C27H23ClN2O — CID 58791114
4-chloro-N-methyl-3-(4-phenylphenyl)-N-(2-pyridin-2-ylethyl)benzamide (PubChem CID 58791114) has the molecular formula C27H23ClN2O and a molecular weight of 426.95 g/mol. Its IUPAC name is 4-chloro-N-methyl-3-(4-phenylphenyl)-N-(2-pyridin-2-ylethyl)benzamide.
| Compound Name | 4-chloro-N-methyl-3-(4-phenylphenyl)-N-(2-pyridin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 58791114 |
| Molecular Formula | C27H23ClN2O |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 4-chloro-N-methyl-3-(4-phenylphenyl)-N-(2-pyridin-2-ylethyl)benzamide |
| SMILES | CN(CCc1ccccn1)C(=O)c1ccc(Cl)c(-c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C27H23ClN2O/c1-30(18-16-24-9-5-6-17-29-24)27(31)23-14-15-26(28)25(19-23)22-12-10-21(11-13-22)20-7-3-2-4-8-20/h2-15,17,19H,16,18H2,1H3 |
| InChIKey | VMRQEDAMMDYFPN-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |