C20H24N2O5 — CID 119173041
4-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)-methylamino]butanoic acid (PubChem CID 119173041) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 4-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)-methylamino]butanoic acid.
| Compound Name | 4-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)-methylamino]butanoic acid |
|---|---|
| PubChem CID | 119173041 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O |
| InChI | InChI=1S/C20H24N2O5/c1-21(11-5-8-17(23)24)18(25)13-9-10-15-16(12-13)20(27)22(19(15)26)14-6-3-2-4-7-14/h9-10,12,14H,2-8,11H2,1H3,(H,23,24) |
| InChIKey | SBSSAXOFQOFHMV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|