C23H31N3O3 — CID 119823932
2-cyclohexyl-1,3-dioxo-N-piperidin-4-yl-N-propylisoindole-5-carboxamide (PubChem CID 119823932) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-cyclohexyl-1,3-dioxo-N-piperidin-4-yl-N-propylisoindole-5-carboxamide.
| Compound Name | 2-cyclohexyl-1,3-dioxo-N-piperidin-4-yl-N-propylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 119823932 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 2-cyclohexyl-1,3-dioxo-N-piperidin-4-yl-N-propylisoindole-5-carboxamide |
| SMILES | CCCN(C(=O)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O)C1CCNCC1 |
| InChI | InChI=1S/C23H31N3O3/c1-2-14-25(17-10-12-24-13-11-17)21(27)16-8-9-19-20(15-16)23(29)26(22(19)28)18-6-4-3-5-7-18/h8-9,15,17-18,24H,2-7,10-14H2,1H3 |
| InChIKey | VCRGITZLNFKCQJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|