C22H31ClN4O3 — CID 119391733
2-cyclohexyl-1,3-dioxo-N-(3-piperazin-1-ylpropyl)isoindole-5-carboxamide;hydrochloride (PubChem CID 119391733) has the molecular formula C22H31ClN4O3 and a molecular weight of 434.97 g/mol. Its IUPAC name is 2-cyclohexyl-1,3-dioxo-N-(3-piperazin-1-ylpropyl)isoindole-5-carboxamide;hydrochloride.
| Compound Name | 2-cyclohexyl-1,3-dioxo-N-(3-piperazin-1-ylpropyl)isoindole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119391733 |
| Molecular Formula | C22H31ClN4O3 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-cyclohexyl-1,3-dioxo-N-(3-piperazin-1-ylpropyl)isoindole-5-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCN1CCNCC1)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O |
| InChI | InChI=1S/C22H30N4O3.ClH/c27-20(24-9-4-12-25-13-10-23-11-14-25)16-7-8-18-19(15-16)22(29)26(21(18)28)17-5-2-1-3-6-17;/h7-8,15,17,23H,1-6,9-14H2,(H,24,27);1H |
| InChIKey | UVVMXMBSBKXBHQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|