C19H24ClN3O3 — CID 119450760
2-cyclohexyl-1,3-dioxo-N-pyrrolidin-3-ylisoindole-5-carboxamide;hydrochloride (PubChem CID 119450760) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is 2-cyclohexyl-1,3-dioxo-N-pyrrolidin-3-ylisoindole-5-carboxamide;hydrochloride.
| Compound Name | 2-cyclohexyl-1,3-dioxo-N-pyrrolidin-3-ylisoindole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119450760 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-cyclohexyl-1,3-dioxo-N-pyrrolidin-3-ylisoindole-5-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCNC1)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O |
| InChI | InChI=1S/C19H23N3O3.ClH/c23-17(21-13-8-9-20-11-13)12-6-7-15-16(10-12)19(25)22(18(15)24)14-4-2-1-3-5-14;/h6-7,10,13-14,20H,1-5,8-9,11H2,(H,21,23);1H |
| InChIKey | SNMFWNXGPOHJIO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|