C15H18N2O3 — CID 32906535
N-butyl-N,2-dimethyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 32906535) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-butyl-N,2-dimethyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-butyl-N,2-dimethyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 32906535 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-butyl-N,2-dimethyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCCCN(C)C(=O)c1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C15H18N2O3/c1-4-5-8-16(2)13(18)10-6-7-11-12(9-10)15(20)17(3)14(11)19/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | QHIWLBSEONXPBI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|