C25H35NO4 — CID 3112633
decyl 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3112633) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is decyl 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | decyl 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3112633 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | decyl 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O |
| InChI | InChI=1S/C25H35NO4/c1-2-3-4-5-6-7-8-12-17-30-25(29)19-15-16-21-22(18-19)24(28)26(23(21)27)20-13-10-9-11-14-20/h15-16,18,20H,2-14,17H2,1H3 |
| InChIKey | GPSABZLBWRGMMM-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|