C40H30Br2N2O5 — CID 167611366
8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione;6-bromo-2-(2-phenylethyl)benzo[de]isoquinoline-1,3-dione;2-phenylethanamine (PubChem CID 167611366) has the molecular formula C40H30Br2N2O5 and a molecular weight of 778.50 g/mol. Its IUPAC name is 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione;6-bromo-2-(2-phenylethyl)benzo[de]isoquinoline-1,3-dione;2-phenylethanamine.
| Compound Name | 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione;6-bromo-2-(2-phenylethyl)benzo[de]isoquinoline-1,3-dione;2-phenylethanamine |
|---|---|
| PubChem CID | 167611366 |
| Molecular Formula | C40H30Br2N2O5 |
| Molecular Weight | 778.50 g/mol |
| Exact Mass | 776.05 |
| IUPAC Name | 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione;6-bromo-2-(2-phenylethyl)benzo[de]isoquinoline-1,3-dione;2-phenylethanamine |
| SMILES | NCCc1ccccc1.O=C1OC(=O)c2ccc(Br)c3cccc1c23.O=C1c2cccc3c(Br)ccc(c23)C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C20H14BrNO2.C12H5BrO3.C8H11N/c21-17-10-9-16-18-14(17)7-4-8-15(18)19(23)22(20(16)24)12-11-13-5-2-1-3-6-13;13-9-5-4-8-10-6(9)2-1-3-7(10)11(14)16-12(8)15;9-7-6-8-4-2-1-3-5-8/h1-10H,11-12H2;1-5H;1-5H,6-7,9H2 |
| InChIKey | LCHGSVPTLCPLEE-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.50 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|