C17H15BrN2O4 — CID 146591578
4-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)butyl carbamate (PubChem CID 146591578) has the molecular formula C17H15BrN2O4 and a molecular weight of 391.22 g/mol. Its IUPAC name is 4-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)butyl carbamate.
| Compound Name | 4-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)butyl carbamate |
|---|---|
| PubChem CID | 146591578 |
| Molecular Formula | C17H15BrN2O4 |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 4-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)butyl carbamate |
| SMILES | NC(=O)OCCCCN1C(=O)c2cccc3c(Br)ccc(c23)C1=O |
| InChI | InChI=1S/C17H15BrN2O4/c18-13-7-6-12-14-10(13)4-3-5-11(14)15(21)20(16(12)22)8-1-2-9-24-17(19)23/h3-7H,1-2,8-9H2,(H2,19,23) |
| InChIKey | DQICIOQFNFRNSO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|