C17H14BrNO4 — CID 15872212
6-bromo-2-(2-hydroperoxy-3-methylbut-3-enyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 15872212) has the molecular formula C17H14BrNO4 and a molecular weight of 376.21 g/mol. Its IUPAC name is 6-bromo-2-(2-hydroperoxy-3-methylbut-3-enyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-bromo-2-(2-hydroperoxy-3-methylbut-3-enyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 15872212 |
| Molecular Formula | C17H14BrNO4 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 6-bromo-2-(2-hydroperoxy-3-methylbut-3-enyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | C=C(C)C(CN1C(=O)c2cccc3c(Br)ccc(c23)C1=O)OO |
| InChI | InChI=1S/C17H14BrNO4/c1-9(2)14(23-22)8-19-16(20)11-5-3-4-10-13(18)7-6-12(15(10)11)17(19)21/h3-7,14,22H,1,8H2,2H3 |
| InChIKey | JDJFKGOJXQSAKD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|