C27H20BrNO2 — CID 122385908
5-bromo-16-pentan-3-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione (PubChem CID 122385908) has the molecular formula C27H20BrNO2 and a molecular weight of 470.37 g/mol. Its IUPAC name is 5-bromo-16-pentan-3-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione.
| Compound Name | 5-bromo-16-pentan-3-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione |
|---|---|
| PubChem CID | 122385908 |
| Molecular Formula | C27H20BrNO2 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 5-bromo-16-pentan-3-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione |
| SMILES | CCC(CC)N1C(=O)c2ccc3c4cccc5c(Br)ccc(c6ccc(c2c36)C1=O)c54 |
| InChI | InChI=1S/C27H20BrNO2/c1-3-14(4-2)29-26(30)20-10-8-17-15-6-5-7-19-22(28)13-12-16(23(15)19)18-9-11-21(27(29)31)25(20)24(17)18/h5-14H,3-4H2,1-2H3 |
| InChIKey | JWZRTLIXYVVFPK-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|