C42H34N2O4 — CID 89018464
11-(4-ethynylphenyl)-7,18-di(pentan-3-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone (PubChem CID 89018464) has the molecular formula C42H34N2O4 and a molecular weight of 630.74 g/mol. Its IUPAC name is 11-(4-ethynylphenyl)-7,18-di(pentan-3-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone.
| Compound Name | 11-(4-ethynylphenyl)-7,18-di(pentan-3-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 89018464 |
| Molecular Formula | C42H34N2O4 |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | 11-(4-ethynylphenyl)-7,18-di(pentan-3-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
| SMILES | C#Cc1ccc(-c2cc3c4c(ccc5c6ccc7c8c(ccc(c2c45)c86)C(=O)N(C(CC)CC)C7=O)C(=O)N(C(CC)CC)C3=O)cc1 |
| InChI | InChI=1S/C42H34N2O4/c1-6-22-11-13-23(14-12-22)32-21-33-37-31(41(47)44(42(33)48)25(9-4)10-5)19-16-27-26-15-18-29-36-30(20-17-28(34(26)36)35(32)38(27)37)40(46)43(39(29)45)24(7-2)8-3/h1,11-21,24-25H,7-10H2,2-5H3 |
| InChIKey | MQUPJWMERHWGCA-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|