C36H30N4O3 — CID 134334260
6,8,17-trioxo-7,18-di(pentan-3-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11,22-dicarbonitrile (PubChem CID 134334260) has the molecular formula C36H30N4O3 and a molecular weight of 566.66 g/mol. Its IUPAC name is 6,8,17-trioxo-7,18-di(pentan-3-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11,22-dicarbonitrile.
| Compound Name | 6,8,17-trioxo-7,18-di(pentan-3-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11,22-dicarbonitrile |
|---|---|
| PubChem CID | 134334260 |
| Molecular Formula | C36H30N4O3 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 6,8,17-trioxo-7,18-di(pentan-3-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11,22-dicarbonitrile |
| SMILES | CCC(CC)N1Cc2cc(C#N)c3c4ccc5c6c(cc(C#N)c(c7ccc(c2c73)C1=O)c64)C(=O)N(C(CC)CC)C5=O |
| InChI | InChI=1S/C36H30N4O3/c1-5-21(6-2)39-17-20-13-18(15-37)28-24-10-12-26-31-27(36(43)40(35(26)42)22(7-3)8-4)14-19(16-38)29(33(24)31)23-9-11-25(34(39)41)30(20)32(23)28/h9-14,21-22H,5-8,17H2,1-4H3 |
| InChIKey | YSOXVCYWYWGANC-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 105.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|