C37H36N2O6 — CID 135271196
11-(2-methoxyethoxy)-7,18-di(pentan-3-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone (PubChem CID 135271196) has the molecular formula C37H36N2O6 and a molecular weight of 604.70 g/mol. Its IUPAC name is 11-(2-methoxyethoxy)-7,18-di(pentan-3-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone.
| Compound Name | 11-(2-methoxyethoxy)-7,18-di(pentan-3-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 135271196 |
| Molecular Formula | C37H36N2O6 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | 11-(2-methoxyethoxy)-7,18-di(pentan-3-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
| SMILES | CCC(CC)N1C(=O)c2ccc3c4ccc5c6c(cc(OCCOC)c(c7ccc(c2c37)C1=O)c64)C(=O)N(C(CC)CC)C5=O |
| InChI | InChI=1S/C37H36N2O6/c1-6-19(7-2)38-34(40)24-13-10-21-22-11-14-26-31-27(37(43)39(36(26)42)20(8-3)9-4)18-28(45-17-16-44-5)32(33(22)31)23-12-15-25(35(38)41)30(24)29(21)23/h10-15,18-20H,6-9,16-17H2,1-5H3 |
| InChIKey | MOMAPQVHGMFGNO-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|