C32H20N4O4 — CID 58151067
22-isocyano-6,8,17,19-tetraoxo-7,18-di(propan-2-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11-carbonitrile (PubChem CID 58151067) has the molecular formula C32H20N4O4 and a molecular weight of 524.54 g/mol. Its IUPAC name is 22-isocyano-6,8,17,19-tetraoxo-7,18-di(propan-2-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11-carbonitrile.
| Compound Name | 22-isocyano-6,8,17,19-tetraoxo-7,18-di(propan-2-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11-carbonitrile |
|---|---|
| PubChem CID | 58151067 |
| Molecular Formula | C32H20N4O4 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 22-isocyano-6,8,17,19-tetraoxo-7,18-di(propan-2-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11-carbonitrile |
| SMILES | [C-]#[N+]c1cc2c3c(ccc4c5c(C#N)cc6c7c(ccc(c1c34)c75)C(=O)N(C(C)C)C6=O)C(=O)N(C(C)C)C2=O |
| InChI | InChI=1S/C32H20N4O4/c1-13(2)35-29(37)18-9-7-17-26-22(34-5)11-21-25-19(30(38)36(14(3)4)32(21)40)8-6-16(28(25)26)23-15(12-33)10-20(31(35)39)24(18)27(17)23/h6-11,13-14H,1-4H3 |
| InChIKey | VQTOKGVHGBGEDJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 102.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|