C25H14N2O2 — CID 58291645
12-isocyano-3,16-dimethyl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaene-15,17-dione (PubChem CID 58291645) has the molecular formula C25H14N2O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 12-isocyano-3,16-dimethyl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaene-15,17-dione.
| Compound Name | 12-isocyano-3,16-dimethyl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaene-15,17-dione |
|---|---|
| PubChem CID | 58291645 |
| Molecular Formula | C25H14N2O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 12-isocyano-3,16-dimethyl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaene-15,17-dione |
| SMILES | [C-]#[N+]c1cc2c3c(ccc4c5c(C)ccc6cccc(c1c34)c65)C(=O)N(C)C2=O |
| InChI | InChI=1S/C25H14N2O2/c1-12-7-8-13-5-4-6-14-20(13)19(12)15-9-10-16-21-17(25(29)27(3)24(16)28)11-18(26-2)22(14)23(15)21/h4-11H,1,3H3 |
| InChIKey | ZJNUYSHMPCVDIW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|