C36H26N4O2 — CID 170899501
2-(3,4-diaminophenyl)-6-[4-(N-phenylanilino)phenyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 170899501) has the molecular formula C36H26N4O2 and a molecular weight of 546.63 g/mol. Its IUPAC name is 2-(3,4-diaminophenyl)-6-[4-(N-phenylanilino)phenyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(3,4-diaminophenyl)-6-[4-(N-phenylanilino)phenyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 170899501 |
| Molecular Formula | C36H26N4O2 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 2-(3,4-diaminophenyl)-6-[4-(N-phenylanilino)phenyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | Nc1ccc(N2C(=O)c3cccc4c(-c5ccc(N(c6ccccc6)c6ccccc6)cc5)ccc(c34)C2=O)cc1N |
| InChI | InChI=1S/C36H26N4O2/c37-32-21-18-27(22-33(32)38)40-35(41)30-13-7-12-29-28(19-20-31(34(29)30)36(40)42)23-14-16-26(17-15-23)39(24-8-3-1-4-9-24)25-10-5-2-6-11-25/h1-22H,37-38H2 |
| InChIKey | SEGYBHIWXWBTQO-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|