C48H33N5O4 — CID 175528416
6-[2,5-dioxo-3,4-bis[4-(N-phenylanilino)phenyl]pyrrol-1-yl]-2,3-dihydrophthalazine-1,4-dione (PubChem CID 175528416) has the molecular formula C48H33N5O4 and a molecular weight of 743.82 g/mol. Its IUPAC name is 6-[2,5-dioxo-3,4-bis[4-(N-phenylanilino)phenyl]pyrrol-1-yl]-2,3-dihydrophthalazine-1,4-dione.
| Compound Name | 6-[2,5-dioxo-3,4-bis[4-(N-phenylanilino)phenyl]pyrrol-1-yl]-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 175528416 |
| Molecular Formula | C48H33N5O4 |
| Molecular Weight | 743.82 g/mol |
| Exact Mass | 743.25 |
| IUPAC Name | 6-[2,5-dioxo-3,4-bis[4-(N-phenylanilino)phenyl]pyrrol-1-yl]-2,3-dihydrophthalazine-1,4-dione |
| SMILES | O=C1C(c2ccc(N(c3ccccc3)c3ccccc3)cc2)=C(c2ccc(N(c3ccccc3)c3ccccc3)cc2)C(=O)N1c1ccc2c(=O)[nH][nH]c(=O)c2c1 |
| InChI | InChI=1S/C48H33N5O4/c54-45-41-30-29-40(31-42(41)46(55)50-49-45)53-47(56)43(32-21-25-38(26-22-32)51(34-13-5-1-6-14-34)35-15-7-2-8-16-35)44(48(53)57)33-23-27-39(28-24-33)52(36-17-9-3-10-18-36)37-19-11-4-12-20-37/h1-31H,(H,49,54)(H,50,55) |
| InChIKey | YHRXIGQNNWVMJL-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.82 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|