C58H36N6O4S — CID 118530599
5-[4-[1,3-dioxo-2-[4-(N-phenylanilino)phenyl]isoindol-5-yl]-2,1,3-benzothiadiazol-7-yl]-2-[4-(N-phenylanilino)phenyl]isoindole-1,3-dione (PubChem CID 118530599) has the molecular formula C58H36N6O4S and a molecular weight of 913.03 g/mol. Its IUPAC name is 5-[4-[1,3-dioxo-2-[4-(N-phenylanilino)phenyl]isoindol-5-yl]-2,1,3-benzothiadiazol-7-yl]-2-[4-(N-phenylanilino)phenyl]isoindole-1,3-dione.
| Compound Name | 5-[4-[1,3-dioxo-2-[4-(N-phenylanilino)phenyl]isoindol-5-yl]-2,1,3-benzothiadiazol-7-yl]-2-[4-(N-phenylanilino)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118530599 |
| Molecular Formula | C58H36N6O4S |
| Molecular Weight | 913.03 g/mol |
| Exact Mass | 912.25 |
| IUPAC Name | 5-[4-[1,3-dioxo-2-[4-(N-phenylanilino)phenyl]isoindol-5-yl]-2,1,3-benzothiadiazol-7-yl]-2-[4-(N-phenylanilino)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc(-c3ccc(-c4ccc5c(c4)C(=O)N(c4ccc(N(c6ccccc6)c6ccccc6)cc4)C5=O)c4nsnc34)cc2C(=O)N1c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C58H36N6O4S/c65-55-49-31-21-37(35-51(49)57(67)63(55)45-27-23-43(24-28-45)61(39-13-5-1-6-14-39)40-15-7-2-8-16-40)47-33-34-48(54-53(47)59-69-60-54)38-22-32-50-52(36-38)58(68)64(56(50)66)46-29-25-44(26-30-46)62(41-17-9-3-10-18-41)42-19-11-4-12-20-42/h1-36H |
| InChIKey | WRQZXJREYOCWET-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 107.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.03 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|