C58H40N6S3 — CID 158787180
N,N-diphenyl-4-(7-phenyl-2,1,3-benzothiadiazol-4-yl)aniline;N,N-diphenyl-4-(4-thiophen-2-yl-2,1,3-benzothiadiazol-7-yl)aniline (PubChem CID 158787180) has the molecular formula C58H40N6S3 and a molecular weight of 917.20 g/mol. Its IUPAC name is N,N-diphenyl-4-(7-phenyl-2,1,3-benzothiadiazol-4-yl)aniline;N,N-diphenyl-4-(4-thiophen-2-yl-2,1,3-benzothiadiazol-7-yl)aniline.
| Compound Name | N,N-diphenyl-4-(7-phenyl-2,1,3-benzothiadiazol-4-yl)aniline;N,N-diphenyl-4-(4-thiophen-2-yl-2,1,3-benzothiadiazol-7-yl)aniline |
|---|---|
| PubChem CID | 158787180 |
| Molecular Formula | C58H40N6S3 |
| Molecular Weight | 917.20 g/mol |
| Exact Mass | 916.25 |
| IUPAC Name | N,N-diphenyl-4-(7-phenyl-2,1,3-benzothiadiazol-4-yl)aniline;N,N-diphenyl-4-(4-thiophen-2-yl-2,1,3-benzothiadiazol-7-yl)aniline |
| SMILES | c1ccc(-c2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c3nsnc23)cc1.c1ccc(N(c2ccccc2)c2ccc(-c3ccc(-c4cccs4)c4nsnc34)cc2)cc1 |
| InChI | InChI=1S/C30H21N3S.C28H19N3S2/c1-4-10-22(11-5-1)27-20-21-28(30-29(27)31-34-32-30)23-16-18-26(19-17-23)33(24-12-6-2-7-13-24)25-14-8-3-9-15-25;1-3-8-21(9-4-1)31(22-10-5-2-6-11-22)23-15-13-20(14-16-23)24-17-18-25(26-12-7-19-32-26)28-27(24)29-33-30-28/h1-21H;1-19H |
| InChIKey | IRVGFBMHFWUYJL-UHFFFAOYSA-N |
| XLogP | 17.05 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.20 |
| LogP ≤ 5 | 17.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |