C29H19N3OS2 — CID 102398558
5-[7-[4-(N-phenylanilino)phenyl]-2,1,3-benzothiadiazol-4-yl]thiophene-2-carbaldehyde (PubChem CID 102398558) has the molecular formula C29H19N3OS2 and a molecular weight of 489.63 g/mol. Its IUPAC name is 5-[7-[4-(N-phenylanilino)phenyl]-2,1,3-benzothiadiazol-4-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[7-[4-(N-phenylanilino)phenyl]-2,1,3-benzothiadiazol-4-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 102398558 |
| Molecular Formula | C29H19N3OS2 |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 5-[7-[4-(N-phenylanilino)phenyl]-2,1,3-benzothiadiazol-4-yl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c3nsnc23)s1 |
| InChI | InChI=1S/C29H19N3OS2/c33-19-24-15-18-27(34-24)26-17-16-25(28-29(26)31-35-30-28)20-11-13-23(14-12-20)32(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-19H |
| InChIKey | SPNQRWGGCGTILA-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|