C32H20N4O2S2 — CID 89433031
[(Z)-1-cyano-2-[5-[7-[4-(N-phenylanilino)phenyl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]ethenyl] formate (PubChem CID 89433031) has the molecular formula C32H20N4O2S2 and a molecular weight of 556.67 g/mol. Its IUPAC name is [(Z)-1-cyano-2-[5-[7-[4-(N-phenylanilino)phenyl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]ethenyl] formate.
| Compound Name | [(Z)-1-cyano-2-[5-[7-[4-(N-phenylanilino)phenyl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]ethenyl] formate |
|---|---|
| PubChem CID | 89433031 |
| Molecular Formula | C32H20N4O2S2 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | [(Z)-1-cyano-2-[5-[7-[4-(N-phenylanilino)phenyl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]ethenyl] formate |
| SMILES | N#C/C(=C/c1ccc(-c2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c3nsnc23)s1)OC=O |
| InChI | InChI=1S/C32H20N4O2S2/c33-20-26(38-21-37)19-27-15-18-30(39-27)29-17-16-28(31-32(29)35-40-34-31)22-11-13-25(14-12-22)36(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-19,21H/b26-19- |
| InChIKey | DZOQJCQTDGTREC-XHPQRKPJSA-N |
| XLogP | 8.59 |
| TPSA | 79.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|