C36H25N3O4S2 — CID 123219950
(Z)-3-[5-[4-[4-[5-[(E)-2-cyano-2-formyloxyethenyl]thiophen-2-yl]-N-(2,4-dimethylphenyl)anilino]phenyl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid (PubChem CID 123219950) has the molecular formula C36H25N3O4S2 and a molecular weight of 627.75 g/mol. Its IUPAC name is (Z)-3-[5-[4-[4-[5-[(E)-2-cyano-2-formyloxyethenyl]thiophen-2-yl]-N-(2,4-dimethylphenyl)anilino]phenyl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[5-[4-[4-[5-[(E)-2-cyano-2-formyloxyethenyl]thiophen-2-yl]-N-(2,4-dimethylphenyl)anilino]phenyl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 123219950 |
| Molecular Formula | C36H25N3O4S2 |
| Molecular Weight | 627.75 g/mol |
| Exact Mass | 627.13 |
| IUPAC Name | (Z)-3-[5-[4-[4-[5-[(E)-2-cyano-2-formyloxyethenyl]thiophen-2-yl]-N-(2,4-dimethylphenyl)anilino]phenyl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C\c1ccc(-c2ccc(N(c3ccc(-c4ccc(/C=C(\C#N)OC=O)s4)cc3)c3ccc(C)cc3C)cc2)s1)C(=O)O |
| InChI | InChI=1S/C36H25N3O4S2/c1-23-4-15-33(24(2)18-23)39(27-9-5-25(6-10-27)34-16-13-30(44-34)19-29(21-37)43-22-40)28-11-7-26(8-12-28)35-17-14-31(45-35)20-32(38-3)36(41)42/h4-20,22H,1-2H3,(H,41,42)/b29-19+,32-20- |
| InChIKey | GEXGNECIHQCLQX-PAUGPDNRSA-N |
| XLogP | 9.61 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.75 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|