C32H24N2O2S2 — CID 59253738
(E)-2-cyano-3-[5-[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 59253738) has the molecular formula C32H24N2O2S2 and a molecular weight of 532.69 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59253738 |
| Molecular Formula | C32H24N2O2S2 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | (E)-2-cyano-3-[5-[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(-c3ccc(-c4ccc(/C=C(\C#N)C(=O)O)s4)s3)cc2)cc1 |
| InChI | InChI=1S/C32H24N2O2S2/c1-21-3-9-25(10-4-21)34(26-11-5-22(2)6-12-26)27-13-7-23(8-14-27)29-17-18-31(38-29)30-16-15-28(37-30)19-24(20-33)32(35)36/h3-19H,1-2H3,(H,35,36)/b24-19+ |
| InChIKey | IVCREUCAIKKUQZ-LYBHJNIJSA-N |
| XLogP | 9.22 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|