C48H36N2O2S2 — CID 77386317
3-[5-[5-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 77386317) has the molecular formula C48H36N2O2S2 and a molecular weight of 736.96 g/mol. Its IUPAC name is 3-[5-[5-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | 3-[5-[5-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 77386317 |
| Molecular Formula | C48H36N2O2S2 |
| Molecular Weight | 736.96 g/mol |
| Exact Mass | 736.22 |
| IUPAC Name | 3-[5-[5-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4ccc(-c5ccc(C=C(C#N)C(=O)O)s5)s4)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C48H36N2O2S2/c1-47(2)39-11-7-5-9-35(39)37-20-17-32(26-41(37)47)50(33-18-21-38-36-10-6-8-12-40(36)48(3,4)42(38)27-33)31-15-13-29(14-16-31)43-23-24-45(54-43)44-22-19-34(53-44)25-30(28-49)46(51)52/h5-27H,1-4H3,(H,51,52) |
| InChIKey | WMQNQIQSGMYKLJ-UHFFFAOYSA-N |
| XLogP | 13.22 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.96 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|