C42H27N3O2S2 — CID 122218801
(E)-2-cyano-3-[5-[5-[4-[2-(N-phenylanilino)carbazol-9-yl]phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 122218801) has the molecular formula C42H27N3O2S2 and a molecular weight of 669.83 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[5-[4-[2-(N-phenylanilino)carbazol-9-yl]phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[5-[4-[2-(N-phenylanilino)carbazol-9-yl]phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 122218801 |
| Molecular Formula | C42H27N3O2S2 |
| Molecular Weight | 669.83 g/mol |
| Exact Mass | 669.15 |
| IUPAC Name | (E)-2-cyano-3-[5-[5-[4-[2-(N-phenylanilino)carbazol-9-yl]phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(-c3ccc(-n4c5ccccc5c5ccc(N(c6ccccc6)c6ccccc6)cc54)cc3)s2)s1)C(=O)O |
| InChI | InChI=1S/C42H27N3O2S2/c43-27-29(42(46)47)25-34-20-22-40(48-34)41-24-23-39(49-41)28-15-17-32(18-16-28)45-37-14-8-7-13-35(37)36-21-19-33(26-38(36)45)44(30-9-3-1-4-10-30)31-11-5-2-6-12-31/h1-26H,(H,46,47)/b29-25+ |
| InChIKey | WHTZNFZXJMILDN-XLVZBRSZSA-N |
| XLogP | 11.70 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.83 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|