C39H28N2O4S4 — CID 123567436
3-[5-[5-[5-[9-(4-butylsulfanylphenyl)carbazol-3-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid;carbon dioxide (PubChem CID 123567436) has the molecular formula C39H28N2O4S4 and a molecular weight of 716.93 g/mol. Its IUPAC name is 3-[5-[5-[5-[9-(4-butylsulfanylphenyl)carbazol-3-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid;carbon dioxide.
| Compound Name | 3-[5-[5-[5-[9-(4-butylsulfanylphenyl)carbazol-3-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid;carbon dioxide |
|---|---|
| PubChem CID | 123567436 |
| Molecular Formula | C39H28N2O4S4 |
| Molecular Weight | 716.93 g/mol |
| Exact Mass | 716.09 |
| IUPAC Name | 3-[5-[5-[5-[9-(4-butylsulfanylphenyl)carbazol-3-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid;carbon dioxide |
| SMILES | CCCCSc1ccc(-n2c3ccccc3c3cc(-c4ccc(-c5ccc(-c6ccc(C=C(C#N)C(=O)O)s6)s5)s4)ccc32)cc1.O=C=O |
| InChI | InChI=1S/C38H28N2O2S4.CO2/c1-2-3-20-43-27-11-9-26(10-12-27)40-31-7-5-4-6-29(31)30-22-24(8-14-32(30)40)33-16-17-36(45-33)37-19-18-35(46-37)34-15-13-28(44-34)21-25(23-39)38(41)42;2-1-3/h4-19,21-22H,2-3,20H2,1H3,(H,41,42); |
| InChIKey | SRBCPGRDYOKBSK-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.93 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|