C42H42N2O2S2 — CID 71022468
(Z)-3-[5-[5-(4-carbazol-9-ylphenyl)-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 71022468) has the molecular formula C42H42N2O2S2 and a molecular weight of 670.94 g/mol. Its IUPAC name is (Z)-3-[5-[5-(4-carbazol-9-ylphenyl)-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[5-[5-(4-carbazol-9-ylphenyl)-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 71022468 |
| Molecular Formula | C42H42N2O2S2 |
| Molecular Weight | 670.94 g/mol |
| Exact Mass | 670.27 |
| IUPAC Name | (Z)-3-[5-[5-(4-carbazol-9-ylphenyl)-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | CCCCCCc1cc(-c2sc(-c3ccc(-n4c5ccccc5c5ccccc54)cc3)cc2CCCCCC)sc1/C=C(/C#N)C(=O)O |
| InChI | InChI=1S/C42H42N2O2S2/c1-3-5-7-9-15-30-25-40(47-39(30)27-32(28-43)42(45)46)41-31(16-10-8-6-4-2)26-38(48-41)29-21-23-33(24-22-29)44-36-19-13-11-17-34(36)35-18-12-14-20-37(35)44/h11-14,17-27H,3-10,15-16H2,1-2H3,(H,45,46)/b32-27- |
| InChIKey | JNLRHAWUAIQYQQ-MXNGAVTRSA-N |
| XLogP | 12.48 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.94 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|