C58H70N2O2S4 — CID 123436309
(Z)-3-[5-[5-[5-[5-(9-ethylcarbazol-3-yl)-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-2-isocyanoprop-2-enoic acid (PubChem CID 123436309) has the molecular formula C58H70N2O2S4 and a molecular weight of 955.48 g/mol. Its IUPAC name is (Z)-3-[5-[5-[5-[5-(9-ethylcarbazol-3-yl)-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-2-isocyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[5-[5-[5-[5-(9-ethylcarbazol-3-yl)-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 123436309 |
| Molecular Formula | C58H70N2O2S4 |
| Molecular Weight | 955.48 g/mol |
| Exact Mass | 954.43 |
| IUPAC Name | (Z)-3-[5-[5-[5-[5-(9-ethylcarbazol-3-yl)-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-3-hexylthiophen-2-yl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C\c1sc(-c2sc(-c3sc(-c4sc(-c5ccc6c(c5)c5ccccc5n6CC)cc4CCCCCC)cc3CCCCCC)cc2CCCCCC)cc1CCCCCC)C(=O)O |
| InChI | InChI=1S/C58H70N2O2S4/c1-7-12-16-20-26-40-35-52(63-51(40)39-47(59-6)58(61)62)55-43(28-22-18-14-9-3)37-54(65-55)57-44(29-23-19-15-10-4)38-53(66-57)56-42(27-21-17-13-8-2)36-50(64-56)41-32-33-49-46(34-41)45-30-24-25-31-48(45)60(49)11-5/h24-25,30-39H,7-23,26-29H2,1-5H3,(H,61,62)/b47-39- |
| InChIKey | LRTNQRSBDWPKSC-MIYFWIETSA-N |
| XLogP | 19.56 |
| TPSA | 46.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.48 |
| LogP ≤ 5 | 19.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|