C46H46N2O2S4 — CID 160615406
(E)-3-[5-[5-[5-[5-(9-ethylcarbazol-3-yl)-4-hexylthiophen-2-yl]-4-hexylthiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid (PubChem CID 160615406) has the molecular formula C46H46N2O2S4 and a molecular weight of 787.15 g/mol. Its IUPAC name is (E)-3-[5-[5-[5-[5-(9-ethylcarbazol-3-yl)-4-hexylthiophen-2-yl]-4-hexylthiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid.
| Compound Name | (E)-3-[5-[5-[5-[5-(9-ethylcarbazol-3-yl)-4-hexylthiophen-2-yl]-4-hexylthiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 160615406 |
| Molecular Formula | C46H46N2O2S4 |
| Molecular Weight | 787.15 g/mol |
| Exact Mass | 786.24 |
| IUPAC Name | (E)-3-[5-[5-[5-[5-(9-ethylcarbazol-3-yl)-4-hexylthiophen-2-yl]-4-hexylthiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C/c1ccc(-c2ccc(-c3cc(CCCCCC)c(-c4cc(CCCCCC)c(-c5ccc6c(c5)c5ccccc5n6CC)s4)s3)s2)s1)C(=O)O |
| InChI | InChI=1S/C46H46N2O2S4/c1-5-8-10-12-16-30-28-43(54-44(30)32-20-22-38-35(26-32)34-18-14-15-19-37(34)48(38)7-3)45-31(17-13-11-9-6-2)27-42(53-45)41-25-24-40(52-41)39-23-21-33(51-39)29-36(47-4)46(49)50/h14-15,18-29H,5-13,16-17H2,1-3H3,(H,49,50)/b36-29+ |
| InChIKey | SVLKOYUJOXCHPC-ZONNCAFXSA-N |
| XLogP | 15.32 |
| TPSA | 46.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.15 |
| LogP ≤ 5 | 15.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|