C48H59NO2S7 — CID 140738675
(Z)-3-[5-[5-[5-[5-(7-hexyl-2,3-dihydrothieno[3,4-b][1,4]dithiin-5-yl)thiophen-2-yl]-3-octylthiophen-2-yl]thiophen-2-yl]-4-octylthiophen-2-yl]-2-isocyanoprop-2-enoic acid (PubChem CID 140738675) has the molecular formula C48H59NO2S7 and a molecular weight of 906.47 g/mol. Its IUPAC name is (Z)-3-[5-[5-[5-[5-(7-hexyl-2,3-dihydrothieno[3,4-b][1,4]dithiin-5-yl)thiophen-2-yl]-3-octylthiophen-2-yl]thiophen-2-yl]-4-octylthiophen-2-yl]-2-isocyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[5-[5-[5-[5-(7-hexyl-2,3-dihydrothieno[3,4-b][1,4]dithiin-5-yl)thiophen-2-yl]-3-octylthiophen-2-yl]thiophen-2-yl]-4-octylthiophen-2-yl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 140738675 |
| Molecular Formula | C48H59NO2S7 |
| Molecular Weight | 906.47 g/mol |
| Exact Mass | 905.26 |
| IUPAC Name | (Z)-3-[5-[5-[5-[5-(7-hexyl-2,3-dihydrothieno[3,4-b][1,4]dithiin-5-yl)thiophen-2-yl]-3-octylthiophen-2-yl]thiophen-2-yl]-4-octylthiophen-2-yl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C\c1cc(CCCCCCCC)c(-c2ccc(-c3sc(-c4ccc(-c5sc(CCCCCC)c6c5SCCS6)s4)cc3CCCCCCCC)s2)s1)C(=O)O |
| InChI | InChI=1S/C48H59NO2S7/c1-5-8-11-14-16-18-21-33-30-35(32-36(49-4)48(50)51)54-43(33)39-26-27-40(56-39)44-34(22-19-17-15-12-9-6-2)31-42(58-44)37-24-25-41(55-37)46-47-45(52-28-29-53-47)38(57-46)23-20-13-10-7-3/h24-27,30-32H,5-23,28-29H2,1-3H3,(H,50,51)/b36-32- |
| InChIKey | SOXPNKURIKKZNW-HIELXXDYSA-N |
| XLogP | 18.13 |
| TPSA | 41.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.47 |
| LogP ≤ 5 | 18.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|