C40H50N2O4S3 — CID 123211704
ethyl (E)-2-cyano-3-[5-[5-[5-[(Z)-3-ethoxy-2-isocyano-3-oxoprop-1-enyl]-3-octylthiophen-2-yl]thiophen-2-yl]-4-octylthiophen-2-yl]prop-2-enoate (PubChem CID 123211704) has the molecular formula C40H50N2O4S3 and a molecular weight of 719.05 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[5-[5-[5-[(Z)-3-ethoxy-2-isocyano-3-oxoprop-1-enyl]-3-octylthiophen-2-yl]thiophen-2-yl]-4-octylthiophen-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[5-[5-[5-[(Z)-3-ethoxy-2-isocyano-3-oxoprop-1-enyl]-3-octylthiophen-2-yl]thiophen-2-yl]-4-octylthiophen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 123211704 |
| Molecular Formula | C40H50N2O4S3 |
| Molecular Weight | 719.05 g/mol |
| Exact Mass | 718.29 |
| IUPAC Name | ethyl (E)-2-cyano-3-[5-[5-[5-[(Z)-3-ethoxy-2-isocyano-3-oxoprop-1-enyl]-3-octylthiophen-2-yl]thiophen-2-yl]-4-octylthiophen-2-yl]prop-2-enoate |
| SMILES | [C-]#[N+]/C(=C\c1cc(CCCCCCCC)c(-c2ccc(-c3sc(/C=C(\C#N)C(=O)OCC)cc3CCCCCCCC)s2)s1)C(=O)OCC |
| InChI | InChI=1S/C40H50N2O4S3/c1-6-10-12-14-16-18-20-29-24-32(26-31(28-41)39(43)45-8-3)47-37(29)35-22-23-36(49-35)38-30(21-19-17-15-13-11-7-2)25-33(48-38)27-34(42-5)40(44)46-9-4/h22-27H,6-21H2,1-4H3/b31-26+,34-27- |
| InChIKey | CMEFIJLMSCBRLA-AKUZGHKNSA-N |
| XLogP | 12.30 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.05 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|